What is the 3,4-Dichlorobenzoyl chloride?

3,4-Dichlorobenzoyl chloride is transparent liquid, while it's Molecular Formula is C7H3Cl3O. transparent liquid Used in Pharmaceutical Industry: 3,4-Dichlorobenzoyl chloride is used as a key intermediate in the synthesis of 3,4-dichlorophenylacetic acid, which is an important compound in the production of various pharmaceuticals. Its role in the synthesis process is crucial for the development of drugs that target specific medical conditions. Used in Chemical Synthesis: 3,4-Dichlorobenzoyl chloride is also used as a reagent in various chemical synthesis processes. Its unique chemical properties make it a valuable component in the creation of different chemical compounds, contributing to the advancement of the chemical industry.

What is the CAS number for 3,4-Dichlorobenzoyl chloride?

The CAS number of 3,4-Dichlorobenzoyl chloride is 3024-72-4.

What is 3,4-Dichlorobenzoyl chloride (3024-72-4) used for?

3,4-Dichlorobenzoyl chloride is a white to yellowish crystalline low melting solid that is primarily used in the synthesis of 3,4-dichlorophenylacetic acid through the Arndt-Eistert method. It is prepared by refluxing 3,4-dichlorobenzoic acid with thionyl chloride.InChI:InChI=1/C8H5Cl3O/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3H,4H2

What is the 3,4-Dichlorobenzoyl chloride?

3,4-Dichlorobenzoyl chloride is transparent liquid, while it's Molecular Formula is C7H3Cl3O. transparent liquid Used in Pharmaceutical Industry: 3,4-Dichlorobenzoyl chloride is used as a key intermediate in the synthesis of 3,4-dichlorophenylacetic acid, which is an important compound in the production of various pharmaceuticals. Its role in the synthesis process is crucial for the development of drugs that target specific medical conditions. Used in Chemical Synthesis: 3,4-Dichlorobenzoyl chloride is also used as a reagent in various chemical synthesis processes. Its unique chemical properties make it a valuable component in the creation of different chemical compounds, contributing to the advancement of the chemical industry.

What is the CAS number for 3,4-Dichlorobenzoyl chloride?

The CAS number of 3,4-Dichlorobenzoyl chloride is 3024-72-4.

What is 3,4-Dichlorobenzoyl chloride (3024-72-4) used for?

3,4-Dichlorobenzoyl chloride is a white to yellowish crystalline low melting solid that is primarily used in the synthesis of 3,4-dichlorophenylacetic acid through the Arndt-Eistert method. It is prepared by refluxing 3,4-dichlorobenzoic acid with thionyl chloride.InChI:InChI=1/C8H5Cl3O/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3H,4H2

3,4-Dichlorobenzoyl chloride

Base Information

Chemical Name: 3,4-Dichlorobenzoyl chloride
CAS No.: 3024-72-4

Reputable factory supply 3,4-Dichlorobenzoyl chloride 3024-72-4 in stock with high standard

Molecular Formula: C7H3Cl3O
Molecular Weight: 209.459
Appearance/Colour: transparent liquid
Vapor Pressure: 0.00223mmHg at 25°C
Melting Point: 30-33 °C(lit.)
Refractive Index: 1.566
Boiling Point: 242 °C at 760 mmHg
Flash Point: 142.2 °C
PSA： 17.07000
Density: 1.498 g/cm³
LogP: 3.37240